C10H14N4O2S — CID 112753725
N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2-oxopyrazin-1-yl)acetamide (PubChem CID 112753725) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2-oxopyrazin-1-yl)acetamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2-oxopyrazin-1-yl)acetamide |
|---|---|
| PubChem CID | 112753725 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2-oxopyrazin-1-yl)acetamide |
| SMILES | CN(CCC(N)=S)C(=O)Cn1ccncc1=O |
| InChI | InChI=1S/C10H14N4O2S/c1-13(4-2-8(11)17)10(16)7-14-5-3-12-6-9(14)15/h3,5-6H,2,4,7H2,1H3,(H2,11,17) |
| InChIKey | YFGRYCVDXNTELI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|