C10H16O3 — CID 11275425
(1S,2R,6S)-2-cyclohexyl-3,4,7-trioxabicyclo[4.1.0]heptane (PubChem CID 11275425) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (1S,2R,6S)-2-cyclohexyl-3,4,7-trioxabicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,6S)-2-cyclohexyl-3,4,7-trioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 11275425 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1S,2R,6S)-2-cyclohexyl-3,4,7-trioxabicyclo[4.1.0]heptane |
| SMILES | C1CCC([C@H]2OOC[C@@H]3O[C@@H]32)CC1 |
| InChI | InChI=1S/C10H16O3/c1-2-4-7(5-3-1)9-10-8(12-10)6-11-13-9/h7-10H,1-6H2/t8-,9+,10-/m0/s1 |
| InChIKey | WWLIBWVKDAAICW-AEJSXWLSSA-N |
| XLogP | 1.66 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|