C13H21BrN2O2 — CID 112754506
4-bromo-N-(2-methoxypropyl)-N-methyl-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 112754506) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 4-bromo-N-(2-methoxypropyl)-N-methyl-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-methoxypropyl)-N-methyl-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 112754506 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-bromo-N-(2-methoxypropyl)-N-methyl-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | COC(C)CN(C)C(=O)c1cc(Br)cn1C(C)C |
| InChI | InChI=1S/C13H21BrN2O2/c1-9(2)16-8-11(14)6-12(16)13(17)15(4)7-10(3)18-5/h6,8-10H,7H2,1-5H3 |
| InChIKey | OCHLDDYUYMQYRV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |