C13H24N2O2 — CID 112754632
N-[[4-(ethylaminomethyl)furan-2-yl]methyl]-2-methoxy-N-methylpropan-1-amine (PubChem CID 112754632) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[[4-(ethylaminomethyl)furan-2-yl]methyl]-2-methoxy-N-methylpropan-1-amine.
| Compound Name | N-[[4-(ethylaminomethyl)furan-2-yl]methyl]-2-methoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 112754632 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-[[4-(ethylaminomethyl)furan-2-yl]methyl]-2-methoxy-N-methylpropan-1-amine |
| SMILES | CCNCc1coc(CN(C)CC(C)OC)c1 |
| InChI | InChI=1S/C13H24N2O2/c1-5-14-7-12-6-13(17-10-12)9-15(3)8-11(2)16-4/h6,10-11,14H,5,7-9H2,1-4H3 |
| InChIKey | AFLZRBIGKLAGFG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |