About S-butyl 4-methylpent-3-enethioate
S-butyl 4-methylpent-3-enethioate (PubChem CID 11275467) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is S-butyl 4-methylpent-3-enethioate.
Molecular Properties
| Compound Name | S-butyl 4-methylpent-3-enethioate |
| PubChem CID | 11275467 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | S-butyl 4-methylpent-3-enethioate |
| SMILES | CCCCSC(=O)CC=C(C)C |
| InChI | InChI=1S/C10H18OS/c1-4-5-8-12-10(11)7-6-9(2)3/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | YTWXRKADWUCEIS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-butyl 4-methylpent-3-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-butyl 4-methylpent-3-enethioate?
The IUPAC name of S-butyl 4-methylpent-3-enethioate (CID 11275467) is S-butyl 4-methylpent-3-enethioate.
What is the SMILES notation for S-butyl 4-methylpent-3-enethioate?
The canonical SMILES for S-butyl 4-methylpent-3-enethioate is CCCCSC(=O)CC=C(C)C.
What is the InChIKey of S-butyl 4-methylpent-3-enethioate?
The InChIKey is YTWXRKADWUCEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS/c1-4-5-8-12-10(11)7-6-9(2)3/h6H,4-5,7-8H2,1-3H3.
What are the key properties of S-butyl 4-methylpent-3-enethioate?
S-butyl 4-methylpent-3-enethioate has a molecular weight of 186.32 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl 4-methylpent-3-enethioate is sourced from PubChem (CID 11275467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).