S-butyl 4-methylpent-3-enethioate

C10H18OS — CID 11275467

IUPACS-butyl 4-methylpent-3-enethioate
SMILESCCCCSC(=O)CC=C(C)C
InChIInChI=1S/C10H18OS/c1-4-5-8-12-10(11)7-6-9(2)3/h6H,4-5,7-8H2,1-3H3
InChIKeyYTWXRKADWUCEIS-UHFFFAOYSA-N
MW186.32 g/mol
LogP3.40
Rot. Bonds5

About S-butyl 4-methylpent-3-enethioate

S-butyl 4-methylpent-3-enethioate (PubChem CID 11275467) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is S-butyl 4-methylpent-3-enethioate.

Molecular Properties

Compound NameS-butyl 4-methylpent-3-enethioate
PubChem CID11275467
Molecular FormulaC10H18OS
Molecular Weight186.32 g/mol
Exact Mass186.11
IUPAC NameS-butyl 4-methylpent-3-enethioate
SMILESCCCCSC(=O)CC=C(C)C
InChIInChI=1S/C10H18OS/c1-4-5-8-12-10(11)7-6-9(2)3/h6H,4-5,7-8H2,1-3H3
InChIKeyYTWXRKADWUCEIS-UHFFFAOYSA-N
XLogP3.40
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.32
LogP ≤ 53.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-butyl 4-methylpent-3-enethioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-butyl 4-methylpent-3-enethioate?
The IUPAC name of S-butyl 4-methylpent-3-enethioate (CID 11275467) is S-butyl 4-methylpent-3-enethioate.
What is the SMILES notation for S-butyl 4-methylpent-3-enethioate?
The canonical SMILES for S-butyl 4-methylpent-3-enethioate is CCCCSC(=O)CC=C(C)C.
What is the InChIKey of S-butyl 4-methylpent-3-enethioate?
The InChIKey is YTWXRKADWUCEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS/c1-4-5-8-12-10(11)7-6-9(2)3/h6H,4-5,7-8H2,1-3H3.
What are the key properties of S-butyl 4-methylpent-3-enethioate?
S-butyl 4-methylpent-3-enethioate has a molecular weight of 186.32 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl 4-methylpent-3-enethioate is sourced from PubChem (CID 11275467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).