About 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile
4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 112755131) has the molecular formula C9H9F3N4O
and a molecular weight of 246.19 g/mol. Its IUPAC name is 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile |
| PubChem CID | 112755131 |
| Molecular Formula | C9H9F3N4O |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cncnc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H9F3N4O/c10-9(11,12)5-17-2-1-15-8-7(3-13)4-14-6-16-8/h4,6H,1-2,5H2,(H,14,15,16) |
| InChIKey | NPACHHLVGCOEFL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile?
The IUPAC name of 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile (CID 112755131) is 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile is N#Cc1cncnc1NCCOCC(F)(F)F.
What is the InChIKey of 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile?
The InChIKey is NPACHHLVGCOEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N4O/c10-9(11,12)5-17-2-1-15-8-7(3-13)4-14-6-16-8/h4,6H,1-2,5H2,(H,14,15,16).
What are the key properties of 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile?
4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile has a molecular weight of 246.19 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbonitrile is sourced from PubChem (CID 112755131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).