About 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide
2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide (PubChem CID 112755465) has the molecular formula C10H15IN4OS
and a molecular weight of 366.23 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 112755465 |
| Molecular Formula | C10H15IN4OS |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide |
| SMILES | NC(=O)C(c1ncc(I)s1)N1CCCNCC1 |
| InChI | InChI=1S/C10H15IN4OS/c11-7-6-14-10(17-7)8(9(12)16)15-4-1-2-13-3-5-15/h6,8,13H,1-5H2,(H2,12,16) |
| InChIKey | YCQKABOHRXJYPF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide (CID 112755465) is 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide is NC(=O)C(c1ncc(I)s1)N1CCCNCC1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide?
The InChIKey is YCQKABOHRXJYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15IN4OS/c11-7-6-14-10(17-7)8(9(12)16)15-4-1-2-13-3-5-15/h6,8,13H,1-5H2,(H2,12,16).
What are the key properties of 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide?
2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide has a molecular weight of 366.23 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-2-(5-iodo-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 112755465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).