C13H22IN3S — CID 112755518
N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine (PubChem CID 112755518) has the molecular formula C13H22IN3S and a molecular weight of 379.31 g/mol. Its IUPAC name is N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine.
| Compound Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 112755518 |
| Molecular Formula | C13H22IN3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine |
| SMILES | CCCCN(Cc1ncc(I)s1)CC1CCCN1 |
| InChI | InChI=1S/C13H22IN3S/c1-2-3-7-17(9-11-5-4-6-15-11)10-13-16-8-12(14)18-13/h8,11,15H,2-7,9-10H2,1H3 |
| InChIKey | RMAOKDRYHIJCGF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|