C10H10O4 — CID 11275564
4-(2-methyl-1,3-dioxolan-2-yl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 11275564) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dioxolan-2-yl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-(2-methyl-1,3-dioxolan-2-yl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 11275564 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-(2-methyl-1,3-dioxolan-2-yl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1(C2=CC(=O)C(=O)C=C2)OCCO1 |
| InChI | InChI=1S/C10H10O4/c1-10(13-4-5-14-10)7-2-3-8(11)9(12)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | JWAXLAQEWPMTGT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|