C11H18O3 — CID 11275639
(1S,5R)-5-[[(2S,3S)-3-ethyloxiran-2-yl]methyl]-2-(hydroxymethyl)cyclopent-2-en-1-ol (PubChem CID 11275639) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (1S,5R)-5-[[(2S,3S)-3-ethyloxiran-2-yl]methyl]-2-(hydroxymethyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,5R)-5-[[(2S,3S)-3-ethyloxiran-2-yl]methyl]-2-(hydroxymethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11275639 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (1S,5R)-5-[[(2S,3S)-3-ethyloxiran-2-yl]methyl]-2-(hydroxymethyl)cyclopent-2-en-1-ol |
| SMILES | CC[C@@H]1O[C@H]1C[C@H]1CC=C(CO)[C@H]1O |
| InChI | InChI=1S/C11H18O3/c1-2-9-10(14-9)5-7-3-4-8(6-12)11(7)13/h4,7,9-13H,2-3,5-6H2,1H3/t7-,9+,10+,11+/m1/s1 |
| InChIKey | VMWLSRTVOZWJGO-PXIYARARSA-N |
| XLogP | 0.85 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|