About 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride
1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride (PubChem CID 112756476) has the molecular formula C9H15ClF3NO
and a molecular weight of 245.67 g/mol. Its IUPAC name is 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride |
| PubChem CID | 112756476 |
| Molecular Formula | C9H15ClF3NO |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride |
| SMILES | CC(=O)C1CCN(CC(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C9H14F3NO.ClH/c1-7(14)8-2-4-13(5-3-8)6-9(10,11)12;/h8H,2-6H2,1H3;1H |
| InChIKey | SFDGQOVLNDHGPT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride?
The IUPAC name of 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride (CID 112756476) is 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride.
What is the SMILES notation for 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride?
The canonical SMILES for 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride is CC(=O)C1CCN(CC(F)(F)F)CC1.Cl.
What is the InChIKey of 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride?
The InChIKey is SFDGQOVLNDHGPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO.ClH/c1-7(14)8-2-4-13(5-3-8)6-9(10,11)12;/h8H,2-6H2,1H3;1H.
What are the key properties of 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride?
1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride has a molecular weight of 245.67 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethanone;hydrochloride is sourced from PubChem (CID 112756476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).