About 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid
3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid (PubChem CID 11275664) has the molecular formula C8H8O6
and a molecular weight of 200.15 g/mol. Its IUPAC name is 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid |
| PubChem CID | 11275664 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid |
| SMILES | CC1=C(C(O)CC(=O)O)C(=O)OC1=O |
| InChI | InChI=1S/C8H8O6/c1-3-6(4(9)2-5(10)11)8(13)14-7(3)12/h4,9H,2H2,1H3,(H,10,11) |
| InChIKey | CFLFWEDIELSWOZ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid?
The IUPAC name of 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid (CID 11275664) is 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid.
What is the SMILES notation for 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid?
The canonical SMILES for 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid is CC1=C(C(O)CC(=O)O)C(=O)OC1=O.
What is the InChIKey of 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid?
The InChIKey is CFLFWEDIELSWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O6/c1-3-6(4(9)2-5(10)11)8(13)14-7(3)12/h4,9H,2H2,1H3,(H,10,11).
What are the key properties of 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid?
3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid has a molecular weight of 200.15 g/mol, XLogP of -0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid is sourced from PubChem (CID 11275664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).