C11H13N3O — CID 112757360
methyl 3-ethylimidazo[1,5-a]pyridine-1-carboximidate (PubChem CID 112757360) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is methyl 3-ethylimidazo[1,5-a]pyridine-1-carboximidate.
| Compound Name | methyl 3-ethylimidazo[1,5-a]pyridine-1-carboximidate |
|---|---|
| PubChem CID | 112757360 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | methyl 3-ethylimidazo[1,5-a]pyridine-1-carboximidate |
| SMILES | [H]/N=C(\OC)c1nc(CC)n2ccccc12 |
| InChI | InChI=1S/C11H13N3O/c1-3-9-13-10(11(12)15-2)8-6-4-5-7-14(8)9/h4-7,12H,3H2,1-2H3/b12-11- |
| InChIKey | QNHHDXPTFFXNKK-QXMHVHEDSA-N |
| XLogP | 1.87 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|