About piperidin-1-yl benzoate
piperidin-1-yl benzoate (PubChem CID 11275749) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is piperidin-1-yl benzoate.
Molecular Properties
| Compound Name | piperidin-1-yl benzoate |
| PubChem CID | 11275749 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | piperidin-1-yl benzoate |
| SMILES | O=C(ON1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c14-12(11-7-3-1-4-8-11)15-13-9-5-2-6-10-13/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | XXZBTNPVRWWWPI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-1-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl benzoate?
The IUPAC name of piperidin-1-yl benzoate (CID 11275749) is piperidin-1-yl benzoate.
What is the SMILES notation for piperidin-1-yl benzoate?
The canonical SMILES for piperidin-1-yl benzoate is O=C(ON1CCCCC1)c1ccccc1.
What is the InChIKey of piperidin-1-yl benzoate?
The InChIKey is XXZBTNPVRWWWPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-12(11-7-3-1-4-8-11)15-13-9-5-2-6-10-13/h1,3-4,7-8H,2,5-6,9-10H2.
What are the key properties of piperidin-1-yl benzoate?
piperidin-1-yl benzoate has a molecular weight of 205.26 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl benzoate is sourced from PubChem (CID 11275749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).