C17H17NO4 — CID 112758397
3-(3-hydroxyphenyl)-2-[(2-phenylacetyl)amino]propanoic acid (PubChem CID 112758397) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-2-[(2-phenylacetyl)amino]propanoic acid.
| Compound Name | 3-(3-hydroxyphenyl)-2-[(2-phenylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 112758397 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(3-hydroxyphenyl)-2-[(2-phenylacetyl)amino]propanoic acid |
| SMILES | O=C(Cc1ccccc1)NC(Cc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C17H17NO4/c19-14-8-4-7-13(9-14)10-15(17(21)22)18-16(20)11-12-5-2-1-3-6-12/h1-9,15,19H,10-11H2,(H,18,20)(H,21,22) |
| InChIKey | JZEIHAVSSWRBTL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |