C13H19N3O2 — CID 112758522
N-methyl-4-[2-(trideuteriomethoxy)phenyl]piperazine-1-carboxamide (PubChem CID 112758522) has the molecular formula C13H19N3O2 and a molecular weight of 252.33 g/mol. Its IUPAC name is N-methyl-4-[2-(trideuteriomethoxy)phenyl]piperazine-1-carboxamide.
| Compound Name | N-methyl-4-[2-(trideuteriomethoxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112758522 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-methyl-4-[2-(trideuteriomethoxy)phenyl]piperazine-1-carboxamide |
| SMILES | [2H]C([2H])([2H])Oc1ccccc1N1CCN(C(=O)NC)CC1 |
| InChI | InChI=1S/C13H19N3O2/c1-14-13(17)16-9-7-15(8-10-16)11-5-3-4-6-12(11)18-2/h3-6H,7-10H2,1-2H3,(H,14,17)/i2D3 |
| InChIKey | ZQNJCCQBAALIAB-BMSJAHLVSA-N |
| XLogP | 1.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |