About 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol
1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol (PubChem CID 112758557) has the molecular formula C23H19I2NO3
and a molecular weight of 611.22 g/mol. Its IUPAC name is 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol.
Molecular Properties
| Compound Name | 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol |
| PubChem CID | 112758557 |
| Molecular Formula | C23H19I2NO3 |
| Molecular Weight | 611.22 g/mol |
| Exact Mass | 610.95 |
| IUPAC Name | 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol |
| SMILES | COc1c(I)cc(Cn2c(-c3ccc(O)cc3)c(C)c3cc(O)ccc32)cc1I |
| InChI | InChI=1S/C23H19I2NO3/c1-13-18-11-17(28)7-8-21(18)26(22(13)15-3-5-16(27)6-4-15)12-14-9-19(24)23(29-2)20(25)10-14/h3-11,27-28H,12H2,1-2H3 |
| InChIKey | QIEITDJNBWYSBB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 611.22 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol?
The IUPAC name of 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol (CID 112758557) is 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol.
What is the SMILES notation for 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol?
The canonical SMILES for 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol is COc1c(I)cc(Cn2c(-c3ccc(O)cc3)c(C)c3cc(O)ccc32)cc1I.
What is the InChIKey of 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol?
The InChIKey is QIEITDJNBWYSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19I2NO3/c1-13-18-11-17(28)7-8-21(18)26(22(13)15-3-5-16(27)6-4-15)12-14-9-19(24)23(29-2)20(25)10-14/h3-11,27-28H,12H2,1-2H3.
What are the key properties of 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol?
1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol has a molecular weight of 611.22 g/mol, XLogP of 6.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-diiodo-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol is sourced from PubChem (CID 112758557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).