C22H27ClN4O2 — CID 112759773
2-[2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]-N-[2-(diethylamino)ethyl]acetamide (PubChem CID 112759773) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]-N-[2-(diethylamino)ethyl]acetamide.
| Compound Name | 2-[2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]-N-[2-(diethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 112759773 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]-N-[2-(diethylamino)ethyl]acetamide |
| SMILES | CCN(CC)CCNC(=O)Cn1c(COc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C22H27ClN4O2/c1-3-26(4-2)14-13-24-22(28)15-27-20-8-6-5-7-19(20)25-21(27)16-29-18-11-9-17(23)10-12-18/h5-12H,3-4,13-16H2,1-2H3,(H,24,28) |
| InChIKey | XVRXDZQEGVDKLY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |