C25H26N2O3 — CID 112760338
(4-benzhydrylpiperazin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone (PubChem CID 112760338) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 112760338 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1O |
| InChI | InChI=1S/C25H26N2O3/c1-30-22-14-8-13-21(24(22)28)25(29)27-17-15-26(16-18-27)23(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-14,23,28H,15-18H2,1H3 |
| InChIKey | XLOQABDMVYWFBK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |