C15H27N — CID 11276079
2-[(1R,3Z,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-yl]propan-2-amine (PubChem CID 11276079) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-[(1R,3Z,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-yl]propan-2-amine.
| Compound Name | 2-[(1R,3Z,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 11276079 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2-[(1R,3Z,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-yl]propan-2-amine |
| SMILES | C/C1=C/C[C@H](C(C)(C)N)CC/C(C)=C\CC1 |
| InChI | InChI=1S/C15H27N/c1-12-6-5-7-13(2)9-11-14(10-8-12)15(3,4)16/h6,9,14H,5,7-8,10-11,16H2,1-4H3/b12-6-,13-9-/t14-/m1/s1 |
| InChIKey | FMELZXAKSAUHLF-IDYIYGFPSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|