C18H22N2OS — CID 112760910
2-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide (PubChem CID 112760910) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | 2-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 112760910 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-phenyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide |
| SMILES | CCCC(C(=O)Nc1nc2c(s1)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C18H22N2OS/c1-2-8-14(13-9-4-3-5-10-13)17(21)20-18-19-15-11-6-7-12-16(15)22-18/h3-5,9-10,14H,2,6-8,11-12H2,1H3,(H,19,20,21) |
| InChIKey | BKFKZZXPJPSRMH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |