C16H22N4O3 — CID 112761265
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-4-ylethyl)acetamide (PubChem CID 112761265) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 112761265 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-pyridin-4-ylethyl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NC(C)c2ccncc2)C1=O |
| InChI | InChI=1S/C16H22N4O3/c1-4-16(5-2)14(22)20(15(23)19-16)10-13(21)18-11(3)12-6-8-17-9-7-12/h6-9,11H,4-5,10H2,1-3H3,(H,18,21)(H,19,23) |
| InChIKey | KHGITRQWDHQIQH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|