About 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene
2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene (PubChem CID 11276152) has the molecular formula C8H7F3S2
and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene.
Molecular Properties
| Compound Name | 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene |
| PubChem CID | 11276152 |
| Molecular Formula | C8H7F3S2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene |
| SMILES | FC(F)=C(F)CCSc1cccs1 |
| InChI | InChI=1S/C8H7F3S2/c9-6(8(10)11)3-5-13-7-2-1-4-12-7/h1-2,4H,3,5H2 |
| InChIKey | GDDIGILLLKSABT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene?
The IUPAC name of 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene (CID 11276152) is 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene.
What is the SMILES notation for 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene?
The canonical SMILES for 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene is FC(F)=C(F)CCSc1cccs1.
What is the InChIKey of 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene?
The InChIKey is GDDIGILLLKSABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3S2/c9-6(8(10)11)3-5-13-7-2-1-4-12-7/h1-2,4H,3,5H2.
What are the key properties of 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene?
2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene has a molecular weight of 224.27 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,4-trifluorobut-3-enylsulfanyl)thiophene is sourced from PubChem (CID 11276152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).