C16H20N4O2S — CID 112761722
[1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]urea (PubChem CID 112761722) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is [1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]urea.
| Compound Name | [1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 112761722 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]urea |
| SMILES | CC(NC(N)=O)C(=O)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C16H20N4O2S/c1-10(18-16(17)22)15(21)20-8-6-11(7-9-20)14-19-12-4-2-3-5-13(12)23-14/h2-5,10-11H,6-9H2,1H3,(H3,17,18,22) |
| InChIKey | AVHJCPPVSGTKLQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |