C12H22O4 — CID 11276279
(2R,4aR,6S,8aS)-2,6-dimethoxy-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 11276279) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (2R,4aR,6S,8aS)-2,6-dimethoxy-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (2R,4aR,6S,8aS)-2,6-dimethoxy-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 11276279 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2R,4aR,6S,8aS)-2,6-dimethoxy-2,6-dimethyl-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | CO[C@]1(C)CC[C@@H]2O[C@@](C)(OC)CC[C@H]2O1 |
| InChI | InChI=1S/C12H22O4/c1-11(13-3)7-5-10-9(15-11)6-8-12(2,14-4)16-10/h9-10H,5-8H2,1-4H3/t9-,10+,11+,12- |
| InChIKey | BHCCWEDEKNEZDN-IWDIQUIJSA-N |
| XLogP | 2.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |