C23H31N3O2S — CID 112763472
4-methyl-2-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 112763472) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 112763472 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 4-methyl-2-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC3CCC2(C)C3(C)C)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C23H31N3O2S/c1-13-17-20(25-16-8-6-5-7-11-26(16)21(17)28)29-18(13)19(27)24-15-12-14-9-10-23(15,4)22(14,2)3/h14-15H,5-12H2,1-4H3,(H,24,27) |
| InChIKey | SYLDRSDOAWTHTN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |