C11H8FNO4 — CID 11276429
ethyl 6-fluoro-2-oxo-1,3-benzoxazine-4-carboxylate (PubChem CID 11276429) has the molecular formula C11H8FNO4 and a molecular weight of 237.19 g/mol. Its IUPAC name is ethyl 6-fluoro-2-oxo-1,3-benzoxazine-4-carboxylate.
| Compound Name | ethyl 6-fluoro-2-oxo-1,3-benzoxazine-4-carboxylate |
|---|---|
| PubChem CID | 11276429 |
| Molecular Formula | C11H8FNO4 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | ethyl 6-fluoro-2-oxo-1,3-benzoxazine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(=O)oc2ccc(F)cc12 |
| InChI | InChI=1S/C11H8FNO4/c1-2-16-10(14)9-7-5-6(12)3-4-8(7)17-11(15)13-9/h3-5H,2H2,1H3 |
| InChIKey | GLPLDOPJUROIGS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |