C14H23NO2 — CID 11276439
(2E,8E,10E)-N-methoxy-N-methyldodeca-2,8,10-trienamide (PubChem CID 11276439) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2E,8E,10E)-N-methoxy-N-methyldodeca-2,8,10-trienamide.
| Compound Name | (2E,8E,10E)-N-methoxy-N-methyldodeca-2,8,10-trienamide |
|---|---|
| PubChem CID | 11276439 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2E,8E,10E)-N-methoxy-N-methyldodeca-2,8,10-trienamide |
| SMILES | C/C=C/C=C/CCCC/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C14H23NO2/c1-4-5-6-7-8-9-10-11-12-13-14(16)15(2)17-3/h4-7,12-13H,8-11H2,1-3H3/b5-4+,7-6+,13-12+ |
| InChIKey | ZAJNSKHAJPOPLQ-YAPKZDNLSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|