C14H12F2N2OS3 — CID 112765234
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1,4-dithiane-2-carboxamide (PubChem CID 112765234) has the molecular formula C14H12F2N2OS3 and a molecular weight of 358.46 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1,4-dithiane-2-carboxamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112765234 |
| Molecular Formula | C14H12F2N2OS3 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)c(F)c2)cs1)C1CSCCS1 |
| InChI | InChI=1S/C14H12F2N2OS3/c15-9-2-1-8(5-10(9)16)11-6-22-14(17-11)18-13(19)12-7-20-3-4-21-12/h1-2,5-6,12H,3-4,7H2,(H,17,18,19) |
| InChIKey | RXPWHAMPCFVDIN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |