C20H28N2O3S2 — CID 112765398
N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-thiophen-2-ylbutanamide (PubChem CID 112765398) has the molecular formula C20H28N2O3S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 112765398 |
| Molecular Formula | C20H28N2O3S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-thiophen-2-ylbutanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)CCCc2cccs2)cc1 |
| InChI | InChI=1S/C20H28N2O3S2/c1-4-22(5-2)27(24,25)19-13-11-17(12-14-19)16(3)21-20(23)10-6-8-18-9-7-15-26-18/h7,9,11-16H,4-6,8,10H2,1-3H3,(H,21,23) |
| InChIKey | FXUZWMDBOBGJEG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |