About 7-iodopyrazolo[1,5-a]pyridine
7-iodopyrazolo[1,5-a]pyridine (PubChem CID 11276590) has the molecular formula C7H5IN2
and a molecular weight of 244.04 g/mol. Its IUPAC name is 7-iodopyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 7-iodopyrazolo[1,5-a]pyridine |
| PubChem CID | 11276590 |
| Molecular Formula | C7H5IN2 |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 7-iodopyrazolo[1,5-a]pyridine |
| SMILES | Ic1cccc2ccnn12 |
| InChI | InChI=1S/C7H5IN2/c8-7-3-1-2-6-4-5-9-10(6)7/h1-5H |
| InChIKey | YWJZQILUQKLMRZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodopyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodopyrazolo[1,5-a]pyridine?
The IUPAC name of 7-iodopyrazolo[1,5-a]pyridine (CID 11276590) is 7-iodopyrazolo[1,5-a]pyridine.
What is the SMILES notation for 7-iodopyrazolo[1,5-a]pyridine?
The canonical SMILES for 7-iodopyrazolo[1,5-a]pyridine is Ic1cccc2ccnn12.
What is the InChIKey of 7-iodopyrazolo[1,5-a]pyridine?
The InChIKey is YWJZQILUQKLMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2/c8-7-3-1-2-6-4-5-9-10(6)7/h1-5H.
What are the key properties of 7-iodopyrazolo[1,5-a]pyridine?
7-iodopyrazolo[1,5-a]pyridine has a molecular weight of 244.04 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodopyrazolo[1,5-a]pyridine is sourced from PubChem (CID 11276590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).