C16H16N2O — CID 11276805
2,8-dimethyl-6-phenyl-3,4-dihydro-2,7-naphthyridin-1-one (PubChem CID 11276805) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2,8-dimethyl-6-phenyl-3,4-dihydro-2,7-naphthyridin-1-one.
| Compound Name | 2,8-dimethyl-6-phenyl-3,4-dihydro-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 11276805 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2,8-dimethyl-6-phenyl-3,4-dihydro-2,7-naphthyridin-1-one |
| SMILES | Cc1nc(-c2ccccc2)cc2c1C(=O)N(C)CC2 |
| InChI | InChI=1S/C16H16N2O/c1-11-15-13(8-9-18(2)16(15)19)10-14(17-11)12-6-4-3-5-7-12/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | OHDJFLAEDQXBQW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |