C22H23ClN4O3 — CID 112768234
2-[(1-benzyl-5-chloro-6-oxopyridazin-4-yl)-ethylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 112768234) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-[(1-benzyl-5-chloro-6-oxopyridazin-4-yl)-ethylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(1-benzyl-5-chloro-6-oxopyridazin-4-yl)-ethylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 112768234 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-[(1-benzyl-5-chloro-6-oxopyridazin-4-yl)-ethylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)c1cnn(Cc2ccccc2)c(=O)c1Cl |
| InChI | InChI=1S/C22H23ClN4O3/c1-3-26(15-20(28)25-17-10-7-11-18(12-17)30-2)19-13-24-27(22(29)21(19)23)14-16-8-5-4-6-9-16/h4-13H,3,14-15H2,1-2H3,(H,25,28) |
| InChIKey | XBBCGJGDDBNCIN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |