C14H19F3N2O3 — CID 112768255
N-(3-butoxypropyl)-4-nitro-3-(trifluoromethyl)aniline (PubChem CID 112768255) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-(3-butoxypropyl)-4-nitro-3-(trifluoromethyl)aniline.
| Compound Name | N-(3-butoxypropyl)-4-nitro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 112768255 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(3-butoxypropyl)-4-nitro-3-(trifluoromethyl)aniline |
| SMILES | CCCCOCCCNc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O3/c1-2-3-8-22-9-4-7-18-11-5-6-13(19(20)21)12(10-11)14(15,16)17/h5-6,10,18H,2-4,7-9H2,1H3 |
| InChIKey | IKSUQCNDLWPVRP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|