C14H23NO3 — CID 11276834
tert-butyl (1R,4S,5S)-4-(1-hydroxyethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 11276834) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl (1R,4S,5S)-4-(1-hydroxyethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | tert-butyl (1R,4S,5S)-4-(1-hydroxyethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 11276834 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl (1R,4S,5S)-4-(1-hydroxyethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CC(O)[C@H]1C=C[C@H]2CC[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO3/c1-9(16)11-7-5-10-6-8-12(11)15(10)13(17)18-14(2,3)4/h5,7,9-12,16H,6,8H2,1-4H3/t9?,10-,11+,12-/m0/s1 |
| InChIKey | PBSBGMGVWACFIV-YATPEIPISA-N |
| XLogP | 2.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|