C15H12F4O2 — CID 112769762
1,2,4,5-tetrafluoro-3-[2-(3-methylphenoxy)ethoxy]benzene (PubChem CID 112769762) has the molecular formula C15H12F4O2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[2-(3-methylphenoxy)ethoxy]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[2-(3-methylphenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 112769762 |
| Molecular Formula | C15H12F4O2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[2-(3-methylphenoxy)ethoxy]benzene |
| SMILES | Cc1cccc(OCCOc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C15H12F4O2/c1-9-3-2-4-10(7-9)20-5-6-21-15-13(18)11(16)8-12(17)14(15)19/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | RTQOXCJEHKBHOS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|