C11H20F5N — CID 11276983
N-butyl-N-(2,2,3,3,3-pentafluoropropyl)butan-1-amine (PubChem CID 11276983) has the molecular formula C11H20F5N and a molecular weight of 261.28 g/mol. Its IUPAC name is N-butyl-N-(2,2,3,3,3-pentafluoropropyl)butan-1-amine.
| Compound Name | N-butyl-N-(2,2,3,3,3-pentafluoropropyl)butan-1-amine |
|---|---|
| PubChem CID | 11276983 |
| Molecular Formula | C11H20F5N |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-butyl-N-(2,2,3,3,3-pentafluoropropyl)butan-1-amine |
| SMILES | CCCCN(CCCC)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5N/c1-3-5-7-17(8-6-4-2)9-10(12,13)11(14,15)16/h3-9H2,1-2H3 |
| InChIKey | LLBDJBWFGKIATQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|