C18H25N3O3 — CID 112770379
N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethyl-5-nitroanilino)acetamide (PubChem CID 112770379) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethyl-5-nitroanilino)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethyl-5-nitroanilino)acetamide |
|---|---|
| PubChem CID | 112770379 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethyl-5-nitroanilino)acetamide |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H25N3O3/c1-13-10-14(2)17(21(23)24)11-16(13)20-12-18(22)19-9-8-15-6-4-3-5-7-15/h6,10-11,20H,3-5,7-9,12H2,1-2H3,(H,19,22) |
| InChIKey | MQRCOPWTQGPGQQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|