C20H31ClN2O2 — CID 112770384
N-(3-chloro-2,6-diethylphenyl)-4-(2,6-dimethylmorpholin-4-yl)butanamide (PubChem CID 112770384) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-4-(2,6-dimethylmorpholin-4-yl)butanamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-4-(2,6-dimethylmorpholin-4-yl)butanamide |
|---|---|
| PubChem CID | 112770384 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-4-(2,6-dimethylmorpholin-4-yl)butanamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)CCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H31ClN2O2/c1-5-16-9-10-18(21)17(6-2)20(16)22-19(24)8-7-11-23-12-14(3)25-15(4)13-23/h9-10,14-15H,5-8,11-13H2,1-4H3,(H,22,24) |
| InChIKey | NXRHVZQJNXMCFC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |