C15H23NO3 — CID 11277087
1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N-ethoxymethanamine (PubChem CID 11277087) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N-ethoxymethanamine.
| Compound Name | 1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N-ethoxymethanamine |
|---|---|
| PubChem CID | 11277087 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N-ethoxymethanamine |
| SMILES | CCONCC1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C15H23NO3/c1-4-19-16-10-11-5-7-13-12(9-11)6-8-14(17-2)15(13)18-3/h6,8,11,16H,4-5,7,9-10H2,1-3H3 |
| InChIKey | QQMYZSPYLAITCL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|