C20H25N5S — CID 112771226
3-(4-tert-butylphenyl)-5-[(1-methylpyrazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 112771226) has the molecular formula C20H25N5S and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-5-[(1-methylpyrazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(4-tert-butylphenyl)-5-[(1-methylpyrazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112771226 |
| Molecular Formula | C20H25N5S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-(4-tert-butylphenyl)-5-[(1-methylpyrazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cnn(C)c2)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25N5S/c1-6-11-25-18(16-7-9-17(10-8-16)20(2,3)4)22-23-19(25)26-14-15-12-21-24(5)13-15/h6-10,12-13H,1,11,14H2,2-5H3 |
| InChIKey | TXTYXUATDCHSPS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|