C21H25Cl2N3O3 — CID 112771667
2-[4-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 112771667) has the molecular formula C21H25Cl2N3O3 and a molecular weight of 438.36 g/mol. Its IUPAC name is 2-[4-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 112771667 |
| Molecular Formula | C21H25Cl2N3O3 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[4-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(CC(O)COc2ccccc2Cl)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H25Cl2N3O3/c22-17-5-1-3-7-19(17)24-21(28)14-26-11-9-25(10-12-26)13-16(27)15-29-20-8-4-2-6-18(20)23/h1-8,16,27H,9-15H2,(H,24,28) |
| InChIKey | WJSASYCIUOFZEK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |