C14H10Cl2N2O4 — CID 112771738
2-(2,4-dichlorophenyl)-N-(2-hydroxy-5-nitrophenyl)acetamide (PubChem CID 112771738) has the molecular formula C14H10Cl2N2O4 and a molecular weight of 341.15 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(2-hydroxy-5-nitrophenyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 112771738 |
| Molecular Formula | C14H10Cl2N2O4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(2-hydroxy-5-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C14H10Cl2N2O4/c15-9-2-1-8(11(16)6-9)5-14(20)17-12-7-10(18(21)22)3-4-13(12)19/h1-4,6-7,19H,5H2,(H,17,20) |
| InChIKey | QMXUGHBQIIKOGJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|