C14H26O3Si — CID 11277249
(5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]non-3-en-2-ol (PubChem CID 11277249) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is (5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]non-3-en-2-ol.
| Compound Name | (5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]non-3-en-2-ol |
|---|---|
| PubChem CID | 11277249 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]non-3-en-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@]12C=CC(O)O2 |
| InChI | InChI=1S/C14H26O3Si/c1-13(2,3)18(4,5)17-11-7-6-9-14(11)10-8-12(15)16-14/h8,10-12,15H,6-7,9H2,1-5H3/t11-,12?,14+/m1/s1 |
| InChIKey | DHPOBIZBIHIZSY-SOGVLRHJSA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|