About 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide
3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide (PubChem CID 11277337) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide.
Molecular Properties
| Compound Name | 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide |
| PubChem CID | 11277337 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide |
| SMILES | O=C(CCC1=CCCN(Cc2ccccc2)C1=O)NO |
| InChI | InChI=1S/C15H18N2O3/c18-14(16-20)9-8-13-7-4-10-17(15(13)19)11-12-5-2-1-3-6-12/h1-3,5-7,20H,4,8-11H2,(H,16,18) |
| InChIKey | VTRRKLMLQRXLMP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide?
The IUPAC name of 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide (CID 11277337) is 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide.
What is the SMILES notation for 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide?
The canonical SMILES for 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide is O=C(CCC1=CCCN(Cc2ccccc2)C1=O)NO.
What is the InChIKey of 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide?
The InChIKey is VTRRKLMLQRXLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c18-14(16-20)9-8-13-7-4-10-17(15(13)19)11-12-5-2-1-3-6-12/h1-3,5-7,20H,4,8-11H2,(H,16,18).
What are the key properties of 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide?
3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide has a molecular weight of 274.32 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyl-6-oxo-2,3-dihydropyridin-5-yl)-N-hydroxypropanamide is sourced from PubChem (CID 11277337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).