C17H25NO2 — CID 11277366
(2R,3S)-3-butyl-N,N-diethyl-2-phenyloxirane-2-carboxamide (PubChem CID 11277366) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (2R,3S)-3-butyl-N,N-diethyl-2-phenyloxirane-2-carboxamide.
| Compound Name | (2R,3S)-3-butyl-N,N-diethyl-2-phenyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 11277366 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (2R,3S)-3-butyl-N,N-diethyl-2-phenyloxirane-2-carboxamide |
| SMILES | CCCC[C@@H]1O[C@]1(C(=O)N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-4-7-13-15-17(20-15,14-11-9-8-10-12-14)16(19)18(5-2)6-3/h8-12,15H,4-7,13H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | ABTFSNXRRCMHFG-DOTOQJQBSA-N |
| XLogP | 3.34 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|