C17H14ClF3N4O2S — CID 1127738
(5S,7R)-3-chloro-5-(furan-2-yl)-N-(thiophen-2-ylmethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1127738) has the molecular formula C17H14ClF3N4O2S and a molecular weight of 430.84 g/mol. Its IUPAC name is (5S,7R)-3-chloro-5-(furan-2-yl)-N-(thiophen-2-ylmethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-3-chloro-5-(furan-2-yl)-N-(thiophen-2-ylmethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1127738 |
| Molecular Formula | C17H14ClF3N4O2S |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (5S,7R)-3-chloro-5-(furan-2-yl)-N-(thiophen-2-ylmethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(NCc1cccs1)c1nn2c(c1Cl)N[C@H](c1ccco1)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C17H14ClF3N4O2S/c18-13-14(16(26)22-8-9-3-2-6-28-9)24-25-12(17(19,20)21)7-10(23-15(13)25)11-4-1-5-27-11/h1-6,10,12,23H,7-8H2,(H,22,26)/t10-,12+/m0/s1 |
| InChIKey | QWEBPXLVJBQLNB-CMPLNLGQSA-N |
| XLogP | 4.78 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |