C18H23N3OS — CID 112774724
3,5-dimethyl-4-[(1-pentylbenzimidazol-2-yl)sulfanylmethyl]-1,2-oxazole (PubChem CID 112774724) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(1-pentylbenzimidazol-2-yl)sulfanylmethyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[(1-pentylbenzimidazol-2-yl)sulfanylmethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 112774724 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3,5-dimethyl-4-[(1-pentylbenzimidazol-2-yl)sulfanylmethyl]-1,2-oxazole |
| SMILES | CCCCCn1c(SCc2c(C)noc2C)nc2ccccc21 |
| InChI | InChI=1S/C18H23N3OS/c1-4-5-8-11-21-17-10-7-6-9-16(17)19-18(21)23-12-15-13(2)20-22-14(15)3/h6-7,9-10H,4-5,8,11-12H2,1-3H3 |
| InChIKey | DKAYNIXFLGAPQJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|