C17H17N5OS — CID 112775926
5-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]pentanenitrile (PubChem CID 112775926) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 5-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]pentanenitrile.
| Compound Name | 5-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112775926 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]pentanenitrile |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCCCCC#N)nnc12 |
| InChI | InChI=1S/C17H17N5OS/c1-2-11-21-15(23)13-8-4-5-9-14(13)22-16(21)19-20-17(22)24-12-7-3-6-10-18/h2,4-5,8-9H,1,3,6-7,11-12H2 |
| InChIKey | FNVJJNNKVQNMTF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|