C13H18O7 — CID 11277616
methyl (3aS,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 11277616) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl (3aS,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 11277616 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl (3aS,6S,7R,7aR)-6-acetyloxy-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2OC(C)(C)O[C@@H]2[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H18O7/c1-6(14)18-10-7(12(16)17-4)5-8-11(9(10)15)20-13(2,3)19-8/h5,8-11,15H,1-4H3/t8-,9+,10-,11-/m0/s1 |
| InChIKey | SOROFKUVWSQEIE-VLEAKVRGSA-N |
| XLogP | -0.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |